C22H28N2O2 — CID 178046707
tert-butyl 6-(4-cyano-2-methylphenyl)-2-(dideuteriomethylidene)-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 178046707) has the molecular formula C22H28N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is tert-butyl 6-(4-cyano-2-methylphenyl)-2-(dideuteriomethylidene)-7-azaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 6-(4-cyano-2-methylphenyl)-2-(dideuteriomethylidene)-7-azaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 178046707 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | tert-butyl 6-(4-cyano-2-methylphenyl)-2-(dideuteriomethylidene)-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | [2H]C([2H])=C1CC2(CCN(C(=O)OC(C)(C)C)C(c3ccc(C#N)cc3C)C2)C1 |
| InChI | InChI=1S/C22H28N2O2/c1-15-11-22(12-15)8-9-24(20(25)26-21(3,4)5)19(13-22)18-7-6-17(14-23)10-16(18)2/h6-7,10,19H,1,8-9,11-13H2,2-5H3/i1D2 |
| InChIKey | FAHDWWRAUDNWRG-DICFDUPASA-N |
| XLogP | 5.28 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|