C25H35FN2O3 — CID 129211946
tert-butyl 2-(4-fluoro-2-methylphenyl)-4-(2-methyl-2-prop-2-enylpent-4-enoyl)piperazine-1-carboxylate (PubChem CID 129211946) has the molecular formula C25H35FN2O3 and a molecular weight of 430.56 g/mol. Its IUPAC name is tert-butyl 2-(4-fluoro-2-methylphenyl)-4-(2-methyl-2-prop-2-enylpent-4-enoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-fluoro-2-methylphenyl)-4-(2-methyl-2-prop-2-enylpent-4-enoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 129211946 |
| Molecular Formula | C25H35FN2O3 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | tert-butyl 2-(4-fluoro-2-methylphenyl)-4-(2-methyl-2-prop-2-enylpent-4-enoyl)piperazine-1-carboxylate |
| SMILES | C=CCC(C)(CC=C)C(=O)N1CCN(C(=O)OC(C)(C)C)C(c2ccc(F)cc2C)C1 |
| InChI | InChI=1S/C25H35FN2O3/c1-8-12-25(7,13-9-2)22(29)27-14-15-28(23(30)31-24(4,5)6)21(17-27)20-11-10-19(26)16-18(20)3/h8-11,16,21H,1-2,12-15,17H2,3-7H3 |
| InChIKey | YXEUOTYTMYOCRX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|