C27H34N2O2 — CID 129211909
2-methyl-1-[(3S)-3-(2-methyl-4-phenylmethoxyphenyl)piperazin-1-yl]-2-prop-2-enylpent-4-en-1-one (PubChem CID 129211909) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 2-methyl-1-[(3S)-3-(2-methyl-4-phenylmethoxyphenyl)piperazin-1-yl]-2-prop-2-enylpent-4-en-1-one.
| Compound Name | 2-methyl-1-[(3S)-3-(2-methyl-4-phenylmethoxyphenyl)piperazin-1-yl]-2-prop-2-enylpent-4-en-1-one |
|---|---|
| PubChem CID | 129211909 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 2-methyl-1-[(3S)-3-(2-methyl-4-phenylmethoxyphenyl)piperazin-1-yl]-2-prop-2-enylpent-4-en-1-one |
| SMILES | C=CCC(C)(CC=C)C(=O)N1CCN[C@@H](c2ccc(OCc3ccccc3)cc2C)C1 |
| InChI | InChI=1S/C27H34N2O2/c1-5-14-27(4,15-6-2)26(30)29-17-16-28-25(19-29)24-13-12-23(18-21(24)3)31-20-22-10-8-7-9-11-22/h5-13,18,25,28H,1-2,14-17,19-20H2,3-4H3/t25-/m1/s1 |
| InChIKey | PLHQUKOJIXYIQF-RUZDIDTESA-N |
| XLogP | 5.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|