C12H15N — CID 106985758
3-cyclopropyl-5-methyl-2,3-dihydro-1H-indole (PubChem CID 106985758) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-cyclopropyl-5-methyl-2,3-dihydro-1H-indole.
| Compound Name | 3-cyclopropyl-5-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106985758 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3-cyclopropyl-5-methyl-2,3-dihydro-1H-indole |
| SMILES | Cc1ccc2c(c1)C(C1CC1)CN2 |
| InChI | InChI=1S/C12H15N/c1-8-2-5-12-10(6-8)11(7-13-12)9-3-4-9/h2,5-6,9,11,13H,3-4,7H2,1H3 |
| InChIKey | WPVYXIAYBFUVJS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |