C10H12IN — CID 130774875
4-iodo-6-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 130774875) has the molecular formula C10H12IN and a molecular weight of 273.12 g/mol. Its IUPAC name is 4-iodo-6-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4-iodo-6-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 130774875 |
| Molecular Formula | C10H12IN |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 4-iodo-6-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1ccc2c(c1)C(I)CCN2 |
| InChI | InChI=1S/C10H12IN/c1-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-3,6,9,12H,4-5H2,1H3 |
| InChIKey | YKCNLZNLUAPREZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|