C10H14N2 — CID 82275529
7-methyl-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 82275529) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 7-methyl-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | 7-methyl-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 82275529 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 7-methyl-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | Cc1ccc2c(c1)NCCC2N |
| InChI | InChI=1S/C10H14N2/c1-7-2-3-8-9(11)4-5-12-10(8)6-7/h2-3,6,9,12H,4-5,11H2,1H3 |
| InChIKey | XGOIXWQXJIAESL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |