C10H14N2S — CID 130741238
(4R)-6-methylsulfanyl-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 130741238) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is (4R)-6-methylsulfanyl-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | (4R)-6-methylsulfanyl-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 130741238 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (4R)-6-methylsulfanyl-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | CSc1ccc2c(c1)[C@H](N)CCN2 |
| InChI | InChI=1S/C10H14N2S/c1-13-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-3,6,9,12H,4-5,11H2,1H3/t9-/m1/s1 |
| InChIKey | IYBZTDVYXFKXOS-SECBINFHSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |