C10H11F3N2 — CID 22735273
6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 22735273) has the molecular formula C10H11F3N2 and a molecular weight of 216.21 g/mol. Its IUPAC name is 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 22735273 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | NC1CCNc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C10H11F3N2/c11-10(12,13)6-1-2-9-7(5-6)8(14)3-4-15-9/h1-2,5,8,15H,3-4,14H2 |
| InChIKey | FODGDPZNCXUYQK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |