C12H16N2 — CID 130909450
(4bS,8aS)-5,6,7,8,8a,9-hexahydro-4bH-carbazol-3-amine (PubChem CID 130909450) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (4bS,8aS)-5,6,7,8,8a,9-hexahydro-4bH-carbazol-3-amine.
| Compound Name | (4bS,8aS)-5,6,7,8,8a,9-hexahydro-4bH-carbazol-3-amine |
|---|---|
| PubChem CID | 130909450 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (4bS,8aS)-5,6,7,8,8a,9-hexahydro-4bH-carbazol-3-amine |
| SMILES | Nc1ccc2c(c1)[C@@H]1CCCC[C@@H]1N2 |
| InChI | InChI=1S/C12H16N2/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h5-7,9,11,14H,1-4,13H2/t9-,11-/m0/s1 |
| InChIKey | KJPSTPLYLNVOAA-ONGXEEELSA-N |
| XLogP | 2.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|