C12H15N — CID 143386629
(4aR)-2,3,4,4a,9,9a-hexahydro-1H-carbazole (PubChem CID 143386629) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (4aR)-2,3,4,4a,9,9a-hexahydro-1H-carbazole.
| Compound Name | (4aR)-2,3,4,4a,9,9a-hexahydro-1H-carbazole |
|---|---|
| PubChem CID | 143386629 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (4aR)-2,3,4,4a,9,9a-hexahydro-1H-carbazole |
| SMILES | c1ccc2c(c1)NC1CCCC[C@H]21 |
| InChI | InChI=1S/C12H15N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1,3,5,7,10,12-13H,2,4,6,8H2/t10-,12?/m1/s1 |
| InChIKey | HYKFPJAARRNNRX-RWANSRKNSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |