C14H19N — CID 129109613
(10aS)-7-methyl-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole (PubChem CID 129109613) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (10aS)-7-methyl-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole.
| Compound Name | (10aS)-7-methyl-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole |
|---|---|
| PubChem CID | 129109613 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (10aS)-7-methyl-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole |
| SMILES | CC1CCC[C@H]2c3ccccc3NC2C1 |
| InChI | InChI=1S/C14H19N/c1-10-5-4-7-12-11-6-2-3-8-13(11)15-14(12)9-10/h2-3,6,8,10,12,14-15H,4-5,7,9H2,1H3/t10?,12-,14?/m0/s1 |
| InChIKey | ZGRLYJIHORJRIK-KHJSKFAYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |