C14H19N — CID 106820245
3-(2-methylcyclopentyl)-2,3-dihydro-1H-indole (PubChem CID 106820245) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-(2-methylcyclopentyl)-2,3-dihydro-1H-indole.
| Compound Name | 3-(2-methylcyclopentyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106820245 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-(2-methylcyclopentyl)-2,3-dihydro-1H-indole |
| SMILES | CC1CCCC1C1CNc2ccccc21 |
| InChI | InChI=1S/C14H19N/c1-10-5-4-7-11(10)13-9-15-14-8-3-2-6-12(13)14/h2-3,6,8,10-11,13,15H,4-5,7,9H2,1H3 |
| InChIKey | GIIJMNYWVHDDMO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |