C16H17N — CID 102145962
(3S,4R)-3-methyl-4-phenyl-1,2,3,4-tetrahydroquinoline (PubChem CID 102145962) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is (3S,4R)-3-methyl-4-phenyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (3S,4R)-3-methyl-4-phenyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 102145962 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (3S,4R)-3-methyl-4-phenyl-1,2,3,4-tetrahydroquinoline |
| SMILES | C[C@@H]1CNc2ccccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H17N/c1-12-11-17-15-10-6-5-9-14(15)16(12)13-7-3-2-4-8-13/h2-10,12,16-17H,11H2,1H3/t12-,16-/m1/s1 |
| InChIKey | AVQZFNNZQPJUQM-MLGOLLRUSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |