C8H9NO — CID 67667878
(3R)-2,3-dihydro-1H-indol-3-ol (PubChem CID 67667878) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is (3R)-2,3-dihydro-1H-indol-3-ol.
| Compound Name | (3R)-2,3-dihydro-1H-indol-3-ol |
|---|---|
| PubChem CID | 67667878 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | (3R)-2,3-dihydro-1H-indol-3-ol |
| SMILES | O[C@H]1CNc2ccccc21 |
| InChI | InChI=1S/C8H9NO/c10-8-5-9-7-4-2-1-3-6(7)8/h1-4,8-10H,5H2/t8-/m0/s1 |
| InChIKey | PXHUCPJKTHEEPU-QMMMGPOBSA-N |
| XLogP | 1.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |