C8H9NO2 — CID 119084044
3-hydroperoxy-2,3-dihydro-1H-indole (PubChem CID 119084044) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 3-hydroperoxy-2,3-dihydro-1H-indole.
| Compound Name | 3-hydroperoxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 119084044 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3-hydroperoxy-2,3-dihydro-1H-indole |
| SMILES | OOC1CNc2ccccc21 |
| InChI | InChI=1S/C8H9NO2/c10-11-8-5-9-7-4-2-1-3-6(7)8/h1-4,8-10H,5H2 |
| InChIKey | GBZYDAAYOOFMTB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|