C16H16N2 — CID 15939421
(4bR,10bR)-4b,5,6,10b,11,12-hexahydroisoquinolino[4,3-c]quinoline (PubChem CID 15939421) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is (4bR,10bR)-4b,5,6,10b,11,12-hexahydroisoquinolino[4,3-c]quinoline.
| Compound Name | (4bR,10bR)-4b,5,6,10b,11,12-hexahydroisoquinolino[4,3-c]quinoline |
|---|---|
| PubChem CID | 15939421 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (4bR,10bR)-4b,5,6,10b,11,12-hexahydroisoquinolino[4,3-c]quinoline |
| SMILES | c1ccc2c(c1)CN[C@H]1c3ccccc3NC[C@@H]21 |
| InChI | InChI=1S/C16H16N2/c1-2-6-12-11(5-1)9-18-16-13-7-3-4-8-15(13)17-10-14(12)16/h1-8,14,16-18H,9-10H2/t14-,16-/m0/s1 |
| InChIKey | PNUZWRVLKMCSKB-HOCLYGCPSA-N |
| XLogP | 3.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |