C13H17N — CID 100962245
(6aR,10aS)-5,6,6a,7,8,9,10,10a-octahydrophenanthridine (PubChem CID 100962245) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (6aR,10aS)-5,6,6a,7,8,9,10,10a-octahydrophenanthridine.
| Compound Name | (6aR,10aS)-5,6,6a,7,8,9,10,10a-octahydrophenanthridine |
|---|---|
| PubChem CID | 100962245 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (6aR,10aS)-5,6,6a,7,8,9,10,10a-octahydrophenanthridine |
| SMILES | c1ccc2c(c1)NC[C@@H]1CCCC[C@H]21 |
| InChI | InChI=1S/C13H17N/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h3-4,7-8,10-11,14H,1-2,5-6,9H2/t10-,11-/m0/s1 |
| InChIKey | FVYMIIXEOZUDRL-QWRGUYRKSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |