C18H18N2 — CID 102272217
(1R,2S,11S,12S)-9,13-diazapentacyclo[10.7.1.02,11.03,8.014,19]icosa-3,5,7,14,16,18-hexaene (PubChem CID 102272217) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is (1R,2S,11S,12S)-9,13-diazapentacyclo[10.7.1.02,11.03,8.014,19]icosa-3,5,7,14,16,18-hexaene.
| Compound Name | (1R,2S,11S,12S)-9,13-diazapentacyclo[10.7.1.02,11.03,8.014,19]icosa-3,5,7,14,16,18-hexaene |
|---|---|
| PubChem CID | 102272217 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (1R,2S,11S,12S)-9,13-diazapentacyclo[10.7.1.02,11.03,8.014,19]icosa-3,5,7,14,16,18-hexaene |
| SMILES | c1ccc2c(c1)NC[C@@H]1[C@@H]2[C@H]2C[C@@H]1Nc1ccccc12 |
| InChI | InChI=1S/C18H18N2/c1-4-8-16-11(5-1)13-9-17(20-16)14-10-19-15-7-3-2-6-12(15)18(13)14/h1-8,13-14,17-20H,9-10H2/t13-,14-,17-,18-/m0/s1 |
| InChIKey | CZKDOPWBRQDQQF-USJZOSNVSA-N |
| XLogP | 3.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |