C13H17N — CID 154876558
8-azatricyclo[8.2.2.02,7]tetradeca-2,4,6-triene (PubChem CID 154876558) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 8-azatricyclo[8.2.2.02,7]tetradeca-2,4,6-triene.
| Compound Name | 8-azatricyclo[8.2.2.02,7]tetradeca-2,4,6-triene |
|---|---|
| PubChem CID | 154876558 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 8-azatricyclo[8.2.2.02,7]tetradeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)NCC1CCC2CC1 |
| InChI | InChI=1S/C13H17N/c1-2-4-13-12(3-1)11-7-5-10(6-8-11)9-14-13/h1-4,10-11,14H,5-9H2 |
| InChIKey | XZRMRGIMDNRLDL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |