C12H16N2 — CID 76853849
N-(cyclopropylmethyl)-2,3-dihydro-1H-indol-3-amine (PubChem CID 76853849) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2,3-dihydro-1H-indol-3-amine.
| Compound Name | N-(cyclopropylmethyl)-2,3-dihydro-1H-indol-3-amine |
|---|---|
| PubChem CID | 76853849 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-(cyclopropylmethyl)-2,3-dihydro-1H-indol-3-amine |
| SMILES | c1ccc2c(c1)NCC2NCC1CC1 |
| InChI | InChI=1S/C12H16N2/c1-2-4-11-10(3-1)12(8-14-11)13-7-9-5-6-9/h1-4,9,12-14H,5-8H2 |
| InChIKey | OQYKKOZUHTXGBB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |