C16H22N2O — CID 80566002
N-(cyclohexylmethyl)-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 80566002) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2,3-dihydro-1H-indole-3-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-2,3-dihydro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 80566002 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-(cyclohexylmethyl)-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | O=C(NCC1CCCCC1)C1CNc2ccccc21 |
| InChI | InChI=1S/C16H22N2O/c19-16(18-10-12-6-2-1-3-7-12)14-11-17-15-9-5-4-8-13(14)15/h4-5,8-9,12,14,17H,1-3,6-7,10-11H2,(H,18,19) |
| InChIKey | LVSCPQHSDNYXLJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |