C16H22N2O2 — CID 106135230
N-[(3-hydroxycyclohexyl)methyl]-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 106135230) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]-2,3-dihydro-1H-indole-3-carboxamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]-2,3-dihydro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 106135230 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | O=C(NCC1CCCC(O)C1)C1CNc2ccccc21 |
| InChI | InChI=1S/C16H22N2O2/c19-12-5-3-4-11(8-12)9-18-16(20)14-10-17-15-7-2-1-6-13(14)15/h1-2,6-7,11-12,14,17,19H,3-5,8-10H2,(H,18,20) |
| InChIKey | CHYZUBBSDAOJPT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |