C12H18N2O — CID 143386559
N-(ethoxymethyl)-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 143386559) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-(ethoxymethyl)-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | N-(ethoxymethyl)-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 143386559 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-(ethoxymethyl)-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | CCOCNC1CCNc2ccccc21 |
| InChI | InChI=1S/C12H18N2O/c1-2-15-9-14-12-7-8-13-11-6-4-3-5-10(11)12/h3-6,12-14H,2,7-9H2,1H3 |
| InChIKey | UGNUQETUDWIRMF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|