C15H22N2 — CID 105488657
N-cyclohexyl-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 105488657) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-cyclohexyl-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | N-cyclohexyl-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 105488657 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-cyclohexyl-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | c1ccc2c(c1)NCCC2NC1CCCCC1 |
| InChI | InChI=1S/C15H22N2/c1-2-6-12(7-3-1)17-15-10-11-16-14-9-5-4-8-13(14)15/h4-5,8-9,12,15-17H,1-3,6-7,10-11H2 |
| InChIKey | MKXGTEFZLNXLHP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |