C13H17ClN2 — CID 105498687
5-chloro-N-cyclobutyl-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 105498687) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 5-chloro-N-cyclobutyl-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | 5-chloro-N-cyclobutyl-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 105498687 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 5-chloro-N-cyclobutyl-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | Clc1cccc2c1C(NC1CCC1)CCN2 |
| InChI | InChI=1S/C13H17ClN2/c14-10-5-2-6-11-13(10)12(7-8-15-11)16-9-3-1-4-9/h2,5-6,9,12,15-16H,1,3-4,7-8H2 |
| InChIKey | HAMAKHUPMJAZFY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |