C9H11ClN2 — CID 142693137
5-chloro-4-methyl-1,2,3,4-tetrahydroquinazoline (PubChem CID 142693137) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 5-chloro-4-methyl-1,2,3,4-tetrahydroquinazoline.
| Compound Name | 5-chloro-4-methyl-1,2,3,4-tetrahydroquinazoline |
|---|---|
| PubChem CID | 142693137 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 5-chloro-4-methyl-1,2,3,4-tetrahydroquinazoline |
| SMILES | CC1NCNc2cccc(Cl)c21 |
| InChI | InChI=1S/C9H11ClN2/c1-6-9-7(10)3-2-4-8(9)12-5-11-6/h2-4,6,11-12H,5H2,1H3 |
| InChIKey | JELJYZYRXUJITH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |