C9H10ClN — CID 131080602
(1R)-4-chloro-1-methyl-2,3-dihydro-1H-isoindole (PubChem CID 131080602) has the molecular formula C9H10ClN and a molecular weight of 167.64 g/mol. Its IUPAC name is (1R)-4-chloro-1-methyl-2,3-dihydro-1H-isoindole.
| Compound Name | (1R)-4-chloro-1-methyl-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 131080602 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | (1R)-4-chloro-1-methyl-2,3-dihydro-1H-isoindole |
| SMILES | C[C@H]1NCc2c(Cl)cccc21 |
| InChI | InChI=1S/C9H10ClN/c1-6-7-3-2-4-9(10)8(7)5-11-6/h2-4,6,11H,5H2,1H3/t6-/m1/s1 |
| InChIKey | RIASFLXJTGZLJH-ZCFIWIBFSA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |