C10H10ClNO2 — CID 170902958
8-chloro-1,2,3,4-tetrahydroisoquinoline-4-carboxylic acid (PubChem CID 170902958) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 8-chloro-1,2,3,4-tetrahydroisoquinoline-4-carboxylic acid.
| Compound Name | 8-chloro-1,2,3,4-tetrahydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 170902958 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 8-chloro-1,2,3,4-tetrahydroisoquinoline-4-carboxylic acid |
| SMILES | O=C(O)C1CNCc2c(Cl)cccc21 |
| InChI | InChI=1S/C10H10ClNO2/c11-9-3-1-2-6-7(9)4-12-5-8(6)10(13)14/h1-3,8,12H,4-5H2,(H,13,14) |
| InChIKey | WFWDVWJNCHUHOF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |