About 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid
9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid (PubChem CID 82386686) has the molecular formula C11H11ClO2S
and a molecular weight of 242.73 g/mol. Its IUPAC name is 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid.
Analyze 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid?
The IUPAC name of 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid (CID 82386686) is 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid.
What is the SMILES notation for 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid?
The canonical SMILES for 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid is O=C(O)C1CCCSc2c(Cl)cccc21.
What is the InChIKey of 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid?
The InChIKey is HLTXRTGCAJVSKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO2S/c12-9-5-1-3-7-8(11(13)14)4-2-6-15-10(7)9/h1,3,5,8H,2,4,6H2,(H,13,14).
What are the key properties of 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid?
9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid has a molecular weight of 242.73 g/mol, XLogP of 3.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-2,3,4,5-tetrahydro-1-benzothiepine-5-carboxylic acid is sourced from PubChem (CID 82386686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).