C8H7ClOS — CID 13162405
7-chloro-2,3-dihydro-1-benzothiophen-3-ol (PubChem CID 13162405) has the molecular formula C8H7ClOS and a molecular weight of 186.66 g/mol. Its IUPAC name is 7-chloro-2,3-dihydro-1-benzothiophen-3-ol.
| Compound Name | 7-chloro-2,3-dihydro-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 13162405 |
| Molecular Formula | C8H7ClOS |
| Molecular Weight | 186.66 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | 7-chloro-2,3-dihydro-1-benzothiophen-3-ol |
| SMILES | OC1CSc2c(Cl)cccc21 |
| InChI | InChI=1S/C8H7ClOS/c9-6-3-1-2-5-7(10)4-11-8(5)6/h1-3,7,10H,4H2 |
| InChIKey | SKPKXJLISPWXHT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |