C10H12ClNO — CID 82125901
3-(aminomethyl)-4-chloro-2,3-dihydro-1H-inden-1-ol (PubChem CID 82125901) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is 3-(aminomethyl)-4-chloro-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 3-(aminomethyl)-4-chloro-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 82125901 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 3-(aminomethyl)-4-chloro-2,3-dihydro-1H-inden-1-ol |
| SMILES | NCC1CC(O)c2cccc(Cl)c21 |
| InChI | InChI=1S/C10H12ClNO/c11-8-3-1-2-7-9(13)4-6(5-12)10(7)8/h1-3,6,9,13H,4-5,12H2 |
| InChIKey | VHRKLVHVKAUEIY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |