C9H8Cl2OS — CID 107311182
(4R)-7,8-dichloro-3,4-dihydro-1H-isothiochromen-4-ol (PubChem CID 107311182) has the molecular formula C9H8Cl2OS and a molecular weight of 235.13 g/mol. Its IUPAC name is (4R)-7,8-dichloro-3,4-dihydro-1H-isothiochromen-4-ol.
| Compound Name | (4R)-7,8-dichloro-3,4-dihydro-1H-isothiochromen-4-ol |
|---|---|
| PubChem CID | 107311182 |
| Molecular Formula | C9H8Cl2OS |
| Molecular Weight | 235.13 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | (4R)-7,8-dichloro-3,4-dihydro-1H-isothiochromen-4-ol |
| SMILES | O[C@H]1CSCc2c1ccc(Cl)c2Cl |
| InChI | InChI=1S/C9H8Cl2OS/c10-7-2-1-5-6(9(7)11)3-13-4-8(5)12/h1-2,8,12H,3-4H2/t8-/m0/s1 |
| InChIKey | PGKZCHINWDIVJO-QMMMGPOBSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |