C10H12O2S — CID 82887429
8-methoxy-3,4-dihydro-1H-isothiochromen-4-ol (PubChem CID 82887429) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is 8-methoxy-3,4-dihydro-1H-isothiochromen-4-ol.
| Compound Name | 8-methoxy-3,4-dihydro-1H-isothiochromen-4-ol |
|---|---|
| PubChem CID | 82887429 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 8-methoxy-3,4-dihydro-1H-isothiochromen-4-ol |
| SMILES | COc1cccc2c1CSCC2O |
| InChI | InChI=1S/C10H12O2S/c1-12-10-4-2-3-7-8(10)5-13-6-9(7)11/h2-4,9,11H,5-6H2,1H3 |
| InChIKey | RUFGMNJVDCRAAV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |