C13H12OS — CID 82885880
(4R)-3,4-dihydro-1H-benzo[h]isothiochromen-4-ol (PubChem CID 82885880) has the molecular formula C13H12OS and a molecular weight of 216.31 g/mol. Its IUPAC name is (4R)-3,4-dihydro-1H-benzo[h]isothiochromen-4-ol.
| Compound Name | (4R)-3,4-dihydro-1H-benzo[h]isothiochromen-4-ol |
|---|---|
| PubChem CID | 82885880 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (4R)-3,4-dihydro-1H-benzo[h]isothiochromen-4-ol |
| SMILES | O[C@H]1CSCc2c1ccc1ccccc21 |
| InChI | InChI=1S/C13H12OS/c14-13-8-15-7-12-10-4-2-1-3-9(10)5-6-11(12)13/h1-6,13-14H,7-8H2/t13-/m0/s1 |
| InChIKey | ONHVTPHQAPKPDE-ZDUSSCGKSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |