C12H10O2 — CID 130127539
1,3-dihydrobenzo[e][2]benzofuran-3-ol (PubChem CID 130127539) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1,3-dihydrobenzo[e][2]benzofuran-3-ol.
| Compound Name | 1,3-dihydrobenzo[e][2]benzofuran-3-ol |
|---|---|
| PubChem CID | 130127539 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 1,3-dihydrobenzo[e][2]benzofuran-3-ol |
| SMILES | OC1OCc2c1ccc1ccccc21 |
| InChI | InChI=1S/C12H10O2/c13-12-10-6-5-8-3-1-2-4-9(8)11(10)7-14-12/h1-6,12-13H,7H2 |
| InChIKey | NXGSFLCUSLAJQF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |