C16H16O3 — CID 103543638
1-(1,3-dioxolan-2-yl)-3-naphthalen-1-ylpropan-2-one (PubChem CID 103543638) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-3-naphthalen-1-ylpropan-2-one.
| Compound Name | 1-(1,3-dioxolan-2-yl)-3-naphthalen-1-ylpropan-2-one |
|---|---|
| PubChem CID | 103543638 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-3-naphthalen-1-ylpropan-2-one |
| SMILES | O=C(Cc1cccc2ccccc12)CC1OCCO1 |
| InChI | InChI=1S/C16H16O3/c17-14(11-16-18-8-9-19-16)10-13-6-3-5-12-4-1-2-7-15(12)13/h1-7,16H,8-11H2 |
| InChIKey | VANNIYXOBKSVBT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |