C13H11ClO2 — CID 100944396
4-chloro-3,4-dihydro-2H-benzo[h]chromen-3-ol (PubChem CID 100944396) has the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. Its IUPAC name is 4-chloro-3,4-dihydro-2H-benzo[h]chromen-3-ol.
| Compound Name | 4-chloro-3,4-dihydro-2H-benzo[h]chromen-3-ol |
|---|---|
| PubChem CID | 100944396 |
| Molecular Formula | C13H11ClO2 |
| Molecular Weight | 234.68 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 4-chloro-3,4-dihydro-2H-benzo[h]chromen-3-ol |
| SMILES | OC1COc2c(ccc3ccccc23)C1Cl |
| InChI | InChI=1S/C13H11ClO2/c14-12-10-6-5-8-3-1-2-4-9(8)13(10)16-7-11(12)15/h1-6,11-12,15H,7H2 |
| InChIKey | OAOWUSFABTYNRO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|