C14H15NO — CID 43537547
3-methyl-3,4-dihydro-2H-benzo[h]chromen-4-amine (PubChem CID 43537547) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-methyl-3,4-dihydro-2H-benzo[h]chromen-4-amine.
| Compound Name | 3-methyl-3,4-dihydro-2H-benzo[h]chromen-4-amine |
|---|---|
| PubChem CID | 43537547 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-methyl-3,4-dihydro-2H-benzo[h]chromen-4-amine |
| SMILES | CC1COc2c(ccc3ccccc23)C1N |
| InChI | InChI=1S/C14H15NO/c1-9-8-16-14-11-5-3-2-4-10(11)6-7-12(14)13(9)15/h2-7,9,13H,8,15H2,1H3 |
| InChIKey | UQNWGYHCBNYUKT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |