C15H12O2 — CID 164680920
(11S,14R)-16-oxatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6,8-pentaen-12-one (PubChem CID 164680920) has the molecular formula C15H12O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is (11S,14R)-16-oxatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6,8-pentaen-12-one.
| Compound Name | (11S,14R)-16-oxatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6,8-pentaen-12-one |
|---|---|
| PubChem CID | 164680920 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (11S,14R)-16-oxatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6,8-pentaen-12-one |
| SMILES | O=C1C[C@H]2COc3c(ccc4ccccc34)[C@@H]12 |
| InChI | InChI=1S/C15H12O2/c16-13-7-10-8-17-15-11-4-2-1-3-9(11)5-6-12(15)14(10)13/h1-6,10,14H,7-8H2/t10-,14-/m0/s1 |
| InChIKey | KCCBFRJDVMFXMW-HZMBPMFUSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |