C22H16NO2+ — CID 11896403
(1R,13R)-12,24-dioxa-25-azoniahexacyclo[11.11.1.02,11.05,10.014,23.017,22]pentacosa-2(11),3,5,7,9,14(23),15,17,19,21-decaene (PubChem CID 11896403) has the molecular formula C22H16NO2+ and a molecular weight of 326.38 g/mol. Its IUPAC name is (1R,13R)-12,24-dioxa-25-azoniahexacyclo[11.11.1.02,11.05,10.014,23.017,22]pentacosa-2(11),3,5,7,9,14(23),15,17,19,21-decaene.
| Compound Name | (1R,13R)-12,24-dioxa-25-azoniahexacyclo[11.11.1.02,11.05,10.014,23.017,22]pentacosa-2(11),3,5,7,9,14(23),15,17,19,21-decaene |
|---|---|
| PubChem CID | 11896403 |
| Molecular Formula | C22H16NO2+ |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (1R,13R)-12,24-dioxa-25-azoniahexacyclo[11.11.1.02,11.05,10.014,23.017,22]pentacosa-2(11),3,5,7,9,14(23),15,17,19,21-decaene |
| SMILES | c1ccc2c3c(ccc2c1)[C@@H]1[NH2+][C@H](O3)c2ccc3ccccc3c2O1 |
| InChI | InChI=1S/C22H15NO2/c1-3-7-15-13(5-1)9-11-17-19(15)24-22-18-12-10-14-6-2-4-8-16(14)20(18)25-21(17)23-22/h1-12,21-23H/p+1/t21-,22-/m1/s1 |
| InChIKey | NGDQJIWFLXLAPA-FGZHOGPDSA-O |
| XLogP | 4.04 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |