C15H13IO2 — CID 132521384
(5S,6R)-5-iodo-6-naphthalen-1-yloxan-2-one (PubChem CID 132521384) has the molecular formula C15H13IO2 and a molecular weight of 352.17 g/mol. Its IUPAC name is (5S,6R)-5-iodo-6-naphthalen-1-yloxan-2-one.
| Compound Name | (5S,6R)-5-iodo-6-naphthalen-1-yloxan-2-one |
|---|---|
| PubChem CID | 132521384 |
| Molecular Formula | C15H13IO2 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | (5S,6R)-5-iodo-6-naphthalen-1-yloxan-2-one |
| SMILES | O=C1CC[C@H](I)[C@@H](c2cccc3ccccc23)O1 |
| InChI | InChI=1S/C15H13IO2/c16-13-8-9-14(17)18-15(13)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13,15H,8-9H2/t13-,15+/m0/s1 |
| InChIKey | QHFMXOXPCQKNNZ-DZGCQCFKSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|