C15H15N — CID 54298424
2-naphthalen-1-yl-2,3,4,5-tetrahydropyridine (PubChem CID 54298424) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-naphthalen-1-yl-2,3,4,5-tetrahydropyridine.
| Compound Name | 2-naphthalen-1-yl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 54298424 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-naphthalen-1-yl-2,3,4,5-tetrahydropyridine |
| SMILES | C1=NC(c2cccc3ccccc23)CCC1 |
| InChI | InChI=1S/C15H15N/c1-2-8-13-12(6-1)7-5-9-14(13)15-10-3-4-11-16-15/h1-2,5-9,11,15H,3-4,10H2 |
| InChIKey | SCKVUCRBCDSIRS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |