C14H13NO — CID 135228169
2-methyl-4-naphthalen-1-yl-4,5-dihydro-1,3-oxazole (PubChem CID 135228169) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-methyl-4-naphthalen-1-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-methyl-4-naphthalen-1-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 135228169 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-methyl-4-naphthalen-1-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC1=NC(c2cccc3ccccc23)CO1 |
| InChI | InChI=1S/C14H13NO/c1-10-15-14(9-16-10)13-8-4-6-11-5-2-3-7-12(11)13/h2-8,14H,9H2,1H3 |
| InChIKey | UVJZCRXUOUVJNW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |