C14H22ClNO — CID 142401664
4-(4-chlorophenyl)-2-methyl-4,5-dihydro-1,3-oxazole;ethane (PubChem CID 142401664) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-methyl-4,5-dihydro-1,3-oxazole;ethane.
| Compound Name | 4-(4-chlorophenyl)-2-methyl-4,5-dihydro-1,3-oxazole;ethane |
|---|---|
| PubChem CID | 142401664 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-(4-chlorophenyl)-2-methyl-4,5-dihydro-1,3-oxazole;ethane |
| SMILES | CC.CC.CC1=NC(c2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C10H10ClNO.2C2H6/c1-7-12-10(6-13-7)8-2-4-9(11)5-3-8;2*1-2/h2-5,10H,6H2,1H3;2*1-2H3 |
| InChIKey | SJFCCICZGWFNGL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |