C12H14ClNO — CID 142401536
4-(4-chlorophenyl)-2-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 142401536) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(4-chlorophenyl)-2-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 142401536 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-(4-chlorophenyl)-2-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)C1=NC(c2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C12H14ClNO/c1-8(2)12-14-11(7-15-12)9-3-5-10(13)6-4-9/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | KLFFODFFMDLGQT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |