C49H38N2O2 — CID 66552817
(4S,5R)-2-[2-[(4S,5R)-4,5-dinaphthalen-1-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dinaphthalen-1-yl-4,5-dihydro-1,3-oxazole (PubChem CID 66552817) has the molecular formula C49H38N2O2 and a molecular weight of 686.86 g/mol. Its IUPAC name is (4S,5R)-2-[2-[(4S,5R)-4,5-dinaphthalen-1-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dinaphthalen-1-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5R)-2-[2-[(4S,5R)-4,5-dinaphthalen-1-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dinaphthalen-1-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 66552817 |
| Molecular Formula | C49H38N2O2 |
| Molecular Weight | 686.86 g/mol |
| Exact Mass | 686.29 |
| IUPAC Name | (4S,5R)-2-[2-[(4S,5R)-4,5-dinaphthalen-1-yl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dinaphthalen-1-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C1=N[C@@H](c2cccc3ccccc23)[C@@H](c2cccc3ccccc23)O1)C1=N[C@@H](c2cccc3ccccc23)[C@@H](c2cccc3ccccc23)O1 |
| InChI | InChI=1S/C49H38N2O2/c1-49(2,47-50-43(39-27-11-19-31-15-3-7-23-35(31)39)45(52-47)41-29-13-21-33-17-5-9-25-37(33)41)48-51-44(40-28-12-20-32-16-4-8-24-36(32)40)46(53-48)42-30-14-22-34-18-6-10-26-38(34)42/h3-30,43-46H,1-2H3/t43-,44-,45+,46+/m0/s1 |
| InChIKey | LODZFKNWMUIBEF-LZCGGXSTSA-N |
| XLogP | 12.45 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.86 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |