C15H16O3 — CID 71348739
(3S,4R)-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-3,4-diol (PubChem CID 71348739) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3S,4R)-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-3,4-diol.
| Compound Name | (3S,4R)-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-3,4-diol |
|---|---|
| PubChem CID | 71348739 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (3S,4R)-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-3,4-diol |
| SMILES | CC1(C)Oc2c(ccc3ccccc23)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H16O3/c1-15(2)14(17)12(16)11-8-7-9-5-3-4-6-10(9)13(11)18-15/h3-8,12,14,16-17H,1-2H3/t12-,14+/m1/s1 |
| InChIKey | LXVCXDIAEYQKEU-OCCSQVGLSA-N |
| XLogP | 2.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |