C20H12BO4- — CID 58795481
4,4'-spirobi[3,5-dioxa-4-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,9,11-pentaene] (PubChem CID 58795481) has the molecular formula C20H12BO4- and a molecular weight of 327.12 g/mol. Its IUPAC name is 4,4'-spirobi[3,5-dioxa-4-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,9,11-pentaene].
| Compound Name | 4,4'-spirobi[3,5-dioxa-4-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,9,11-pentaene] |
|---|---|
| PubChem CID | 58795481 |
| Molecular Formula | C20H12BO4- |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4,4'-spirobi[3,5-dioxa-4-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),7,9,11-pentaene] |
| SMILES | c1ccc2c3c(ccc2c1)O[B-]1(Oc2ccc4ccccc4c2O1)O3 |
| InChI | InChI=1S/C20H12BO4/c1-3-7-15-13(5-1)9-11-17-19(15)24-21(22-17)23-18-12-10-14-6-2-4-8-16(14)20(18)25-21/h1-12H/q-1 |
| InChIKey | YMPYBPLYVFJOQU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|