C13H10O2 — CID 176766082
2-ethenylbenzo[g][1,3]benzodioxole (PubChem CID 176766082) has the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-ethenylbenzo[g][1,3]benzodioxole.
| Compound Name | 2-ethenylbenzo[g][1,3]benzodioxole |
|---|---|
| PubChem CID | 176766082 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-ethenylbenzo[g][1,3]benzodioxole |
| SMILES | C=CC1Oc2ccc3ccccc3c2O1 |
| InChI | InChI=1S/C13H10O2/c1-2-12-14-11-8-7-9-5-3-4-6-10(9)13(11)15-12/h2-8,12H,1H2 |
| InChIKey | TWVROFOLMUOVGG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|