C13H12O3 — CID 102377836
[(2R)-2,3-dihydrobenzo[h][1,4]benzodioxin-2-yl]methanol (PubChem CID 102377836) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is [(2R)-2,3-dihydrobenzo[h][1,4]benzodioxin-2-yl]methanol.
| Compound Name | [(2R)-2,3-dihydrobenzo[h][1,4]benzodioxin-2-yl]methanol |
|---|---|
| PubChem CID | 102377836 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | [(2R)-2,3-dihydrobenzo[h][1,4]benzodioxin-2-yl]methanol |
| SMILES | OC[C@@H]1COc2ccc3ccccc3c2O1 |
| InChI | InChI=1S/C13H12O3/c14-7-10-8-15-12-6-5-9-3-1-2-4-11(9)13(12)16-10/h1-6,10,14H,7-8H2/t10-/m1/s1 |
| InChIKey | AXDTTXSWSDJBQS-SNVBAGLBSA-N |
| XLogP | 1.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |